Products 4755-59-3
CAS 4755-59-3 is the registry number for Clodazon. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-chloro-1-[3-(dimethylamino)propyl]-3-phenylbenzimidazol-2-one (CAS 4755-59-3) is a chemical compound with the molecular formula C18H20ClN3O and a molecular weight of 329.8 g/mol. IUPAC name: 5-chloro-1-[3-(dimethylamino)propyl]-3-phenylbenzimidazol-2-one. InChIKey: VWXGRWMELBPMCU-UHFFFAOYSA-N.
| Molecular formula | C18H20ClN3O |
|---|---|
| Molecular weight | 329.8 g/mol |
| IUPAC name | 5-chloro-1-[3-(dimethylamino)propyl]-3-phenylbenzimidazol-2-one |
| InChIKey | VWXGRWMELBPMCU-UHFFFAOYSA-N |
| SMILES | CN(C)CCCN1C2=C(C=C(C=C2)Cl)N(C1=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)