CAS 475576-83-1 is the registry number for 2,7,8-Triamino-4-(3-bromo-4,5-dimethoxyphenyl)-4h-chromene-3-carbonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 5g.
2,7,8-triamino-4-(3-bromo-4,5-dimethoxyphenyl)-4H-chromene-3-carbonitrile (CAS 475576-83-1) is a chemical compound with the molecular formula C18H17BrN4O3 and a molecular weight of 417.3 g/mol. IUPAC name: 2,7,8-triamino-4-(3-bromo-4,5-dimethoxyphenyl)-4H-chromene-3-carbonitrile. InChIKey: JXONINOYTKKXQQ-UHFFFAOYSA-N.
| Molecular formula | C18H17BrN4O3 |
|---|---|
| Molecular weight | 417.3 g/mol |
| IUPAC name | 2,7,8-triamino-4-(3-bromo-4,5-dimethoxyphenyl)-4H-chromene-3-carbonitrile |
| InChIKey | JXONINOYTKKXQQ-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC(=C1)C2C3=C(C(=C(C=C3)N)N)OC(=C2C#N)N)Br)OC |
Computed by PubChem (NCBI)