CAS 4756-30-3 appears in our catalog under these names: (2S,3R,4S,5S,6R)-2-(4-Chlorophenoxy)-6-(hydroxymethyl)tetrahydro-2H-pyran-3,4,5-triol, 98%, 4-Chlorophenyl b-D-glucopyranoside. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 10g, 5g, 25g, 100g, 50g.
(2S,3R,4S,5S,6R)-2-(4-chlorophenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol (CAS 4756-30-3) is a chemical compound with the molecular formula C12H15ClO6 and a molecular weight of 290.69 g/mol. IUPAC name: (2S,3R,4S,5S,6R)-2-(4-chlorophenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol. InChIKey: VTNZLQTUEWINQW-RMPHRYRLSA-N.
| Molecular formula | C12H15ClO6 |
|---|---|
| Molecular weight | 290.69 g/mol |
| IUPAC name | (2S,3R,4S,5S,6R)-2-(4-chlorophenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol |
| InChIKey | VTNZLQTUEWINQW-RMPHRYRLSA-N |
| SMILES | C1=CC(=CC=C1O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O)Cl |
Computed by PubChem (NCBI)