CAS 4762-26-9 appears in our catalog under these names: Hexyltriphenylphosphonium bromide, 97%, Hexyltriphenylphosphonium Bromide, Hexyltriphenylphosphonium bromide, (1-Hexyl)triphenylphosphonium bromide, 98% , Hexyltriphenylphosphonium Bromide, >98.0%(HPLC)(T). Offered by: Combi-blocks, TRC, GLPBio, Thermo Scientific (Alfa Aesar), TCI. Available pack sizes: 5g, 500g, 100g, 25g, 2,5g, 250mg, 500mg.
Hexyl(triphenyl)phosphanium bromide (CAS 4762-26-9) is a chemical compound with the molecular formula C24H28BrP and a molecular weight of 427.4 g/mol. IUPAC name: hexyl(triphenyl)phosphanium bromide. InChIKey: PWDFZWZPWFYFTC-UHFFFAOYSA-M.
| Molecular formula | C24H28BrP |
|---|---|
| Molecular weight | 427.4 g/mol |
| IUPAC name | hexyl(triphenyl)phosphanium bromide |
| InChIKey | PWDFZWZPWFYFTC-UHFFFAOYSA-M |
| SMILES | CCCCCC[P+](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3.[Br-] |
Computed by PubChem (NCBI)