CAS 476213-99-7 is the registry number for  2-((2,3,4,6-Tetra-O-acetyl-α-D-mannopyranosyl)oxy)acetic acid. Offered by: Biosynth. Available pack sizes: 1g.
2-[(2S,4R,5R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyacetic acid (CAS 476213-99-7) is a chemical compound with the molecular formula C16H22O12 and a molecular weight of 406.34 g/mol. IUPAC name: 2-[(2S,4R,5R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyacetic acid. InChIKey: TWWYGXIQWBPJMT-OMWDCTEDSA-N.
| Molecular formula | C16H22O12 |
|---|---|
| Molecular weight | 406.34 g/mol |
| IUPAC name | 2-[(2S,4R,5R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyacetic acid |
| InChIKey | TWWYGXIQWBPJMT-OMWDCTEDSA-N |
| SMILES | CC(=O)OCC1[C@H]([C@H](C([C@H](O1)OCC(=O)O)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)