CAS 476371-89-8 is the registry number for (2R,3E)-2,4-Dimethyl-2-((1-oxopropyl)thio)-3,5-hexadienoic Acid Ethyl Ester. Offered by: TRC. Available pack sizes: 10mg, 25mg, 5mg.
Ethyl (2R,3E)-2,4-dimethyl-2-propanoylsulfanylhexa-3,5-dienoate (CAS 476371-89-8) is a chemical compound with the molecular formula C13H20O3S and a molecular weight of 256.36 g/mol. IUPAC name: ethyl (2R,3E)-2,4-dimethyl-2-propanoylsulfanylhexa-3,5-dienoate. InChIKey: BYKKTANHOVEOAG-WTNCMQEWSA-N.
| Molecular formula | C13H20O3S |
|---|---|
| Molecular weight | 256.36 g/mol |
| IUPAC name | ethyl (2R,3E)-2,4-dimethyl-2-propanoylsulfanylhexa-3,5-dienoate |
| InChIKey | BYKKTANHOVEOAG-WTNCMQEWSA-N |
| SMILES | CCC(=O)S[C@](C)(/C=C(\C)/C=C)C(=O)OCC |
Computed by PubChem (NCBI)