Products 476633-98-4
CAS 476633-98-4 appears in our catalog under these names: WAY-270360, Sirtuin modulator 6, 99.70%, N-(4-(1H-benzo[d]imidazol-2-yl)phenyl)-2,4-dimethoxybenzamide, 98%. Offered by: TargetMol, MedChemExpress, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 50 mg.
N-[4-(1H-benzimidazol-2-yl)phenyl]-2,4-dimethoxybenzamide (CAS 476633-98-4) is a chemical compound with the molecular formula C22H19N3O3 and a molecular weight of 373.4 g/mol. IUPAC name: N-[4-(1H-benzimidazol-2-yl)phenyl]-2,4-dimethoxybenzamide. InChIKey: FTPMCWPNLDTGMY-UHFFFAOYSA-N.
| Molecular formula | C22H19N3O3 |
|---|---|
| Molecular weight | 373.4 g/mol |
| IUPAC name | N-[4-(1H-benzimidazol-2-yl)phenyl]-2,4-dimethoxybenzamide |
| InChIKey | FTPMCWPNLDTGMY-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)C(=O)NC2=CC=C(C=C2)C3=NC4=CC=CC=C4N3)OC |
Computed by PubChem (NCBI)