CAS 476643-66-0 is the registry number for Ethyl (Z)-2-((2,6-difluorobenzoyl)imino)-3,4-dimethyl-2,3-dihydrothiazole-5-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg.
Ethyl 2-(2,6-difluorobenzoyl)imino-3,4-dimethyl-1,3-thiazole-5-carboxylate (CAS 476643-66-0) is a chemical compound with the molecular formula C15H14F2N2O3S and a molecular weight of 340.3 g/mol. IUPAC name: ethyl 2-(2,6-difluorobenzoyl)imino-3,4-dimethyl-1,3-thiazole-5-carboxylate. InChIKey: GCSGDLCLMMMXNT-UHFFFAOYSA-N.
| Molecular formula | C15H14F2N2O3S |
|---|---|
| Molecular weight | 340.3 g/mol |
| IUPAC name | ethyl 2-(2,6-difluorobenzoyl)imino-3,4-dimethyl-1,3-thiazole-5-carboxylate |
| InChIKey | GCSGDLCLMMMXNT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N(C(=NC(=O)C2=C(C=CC=C2F)F)S1)C)C |
Computed by PubChem (NCBI)