CAS 476646-93-2 is the registry number for 2–Acetylbutyrolactone–3,3,4,4–d4. Offered by: GLPBio. Available pack sizes: 100mg.
3-acetyl-4,4,5,5-tetradeuteriooxolan-2-one (CAS 476646-93-2) is a chemical compound with the molecular formula C6H8O3 and a molecular weight of 132.15 g/mol. IUPAC name: 3-acetyl-4,4,5,5-tetradeuteriooxolan-2-one. InChIKey: OMQHDIHZSDEIFH-RRVWJQJTSA-N.
| Molecular formula | C6H8O3 |
|---|---|
| Molecular weight | 132.15 g/mol |
| IUPAC name | 3-acetyl-4,4,5,5-tetradeuteriooxolan-2-one |
| InChIKey | OMQHDIHZSDEIFH-RRVWJQJTSA-N |
| SMILES | [2H]C1(C(C(=O)OC1([2H])[2H])C(=O)C)[2H] |
Computed by PubChem (NCBI)