Products 4767-54-8
CAS 4767-54-8 appears in our catalog under these names: Butylphthalide Impurity 50, 3-(Propan-2-ylidene)isobenzofuran-1(3H)-one, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
3-propan-2-ylidene-2-benzofuran-1-one (CAS 4767-54-8) is a chemical compound with the molecular formula C11H10O2 and a molecular weight of 174.20 g/mol. IUPAC name: 3-propan-2-ylidene-2-benzofuran-1-one. InChIKey: UYTQKTLMMLDERF-UHFFFAOYSA-N.
| Molecular formula | C11H10O2 |
|---|---|
| Molecular weight | 174.20 g/mol |
| IUPAC name | 3-propan-2-ylidene-2-benzofuran-1-one |
| InChIKey | UYTQKTLMMLDERF-UHFFFAOYSA-N |
| SMILES | CC(=C1C2=CC=CC=C2C(=O)O1)C |
Computed by PubChem (NCBI)