CAS 477-52-1 appears in our catalog under these names: beta-Apopicropodophyllin, β-Apopicropodophyllin. Offered by: TRC, MedChemExpress. Available pack sizes: 250mg, Get quote.
(5R)-5-(3,4,5-trimethoxyphenyl)-8,9-dihydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-6-one (CAS 477-52-1) is a chemical compound with the molecular formula C22H20O7 and a molecular weight of 396.4 g/mol. IUPAC name: (5R)-5-(3,4,5-trimethoxyphenyl)-8,9-dihydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-6-one. InChIKey: OPGVEBTYBAOEHZ-LJQANCHMSA-N.
| Molecular formula | C22H20O7 |
|---|---|
| Molecular weight | 396.4 g/mol |
| IUPAC name | (5R)-5-(3,4,5-trimethoxyphenyl)-8,9-dihydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-6-one |
| InChIKey | OPGVEBTYBAOEHZ-LJQANCHMSA-N |
| SMILES | COC1=CC(=CC(=C1OC)OC)[C@@H]2C3=CC4=C(C=C3CC5=C2C(=O)OC5)OCO4 |
Computed by PubChem (NCBI)