CAS 477204-94-7 is the registry number for 1-(2-Thienylcarbonyl)piperazine trifluoroacetate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
Piperazin-1-yl(thiophen-2-yl)methanone;2,2,2-trifluoroacetic acid (CAS 477204-94-7) is a chemical compound with the molecular formula C11H13F3N2O3S and a molecular weight of 310.29 g/mol. IUPAC name: piperazin-1-yl(thiophen-2-yl)methanone;2,2,2-trifluoroacetic acid. InChIKey: BLRUMSYYHSFSKQ-UHFFFAOYSA-N.
| Molecular formula | C11H13F3N2O3S |
|---|---|
| Molecular weight | 310.29 g/mol |
| IUPAC name | piperazin-1-yl(thiophen-2-yl)methanone;2,2,2-trifluoroacetic acid |
| InChIKey | BLRUMSYYHSFSKQ-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C(=O)C2=CC=CS2.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)