CAS 477313-09-0 appears in our catalog under these names: (±)-AC 7954 hydrochloride/ 99.42% (existing batch purity), (±)–AC 7954 hydrochloride, 3-(4-Chlorophenyl)-3-(2-(dimethylamino)ethyl)isochroman-1-one hydrochloride, ≥98%, ≥98%, AC-7954. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 10 mg.
3-(4-chlorophenyl)-3-[2-(dimethylamino)ethyl]-4H-isochromen-1-one;hydrochloride (CAS 477313-09-0) is a chemical compound with the molecular formula C19H21Cl2NO2 and a molecular weight of 366.3 g/mol. IUPAC name: 3-(4-chlorophenyl)-3-[2-(dimethylamino)ethyl]-4H-isochromen-1-one;hydrochloride. InChIKey: AJPGLOWFIBOGMH-UHFFFAOYSA-N.
| Molecular formula | C19H21Cl2NO2 |
|---|---|
| Molecular weight | 366.3 g/mol |
| IUPAC name | 3-(4-chlorophenyl)-3-[2-(dimethylamino)ethyl]-4H-isochromen-1-one;hydrochloride |
| InChIKey | AJPGLOWFIBOGMH-UHFFFAOYSA-N |
| SMILES | CN(C)CCC1(CC2=CC=CC=C2C(=O)O1)C3=CC=C(C=C3)Cl.Cl |
Computed by PubChem (NCBI)