CAS 477339-39-2 is the registry number for (S)-(-)-2-((1-Hydroxy-3,3-dimethylbutan-2-ylimino)methyl)-4,6-diiodophenol. Offered by: Biosynth. Available pack sizes: 0,05g, 0,025g, 0,1g, 0,5g, 0,25g.
2-[[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]iminomethyl]-4,6-diiodophenol (CAS 477339-39-2) is a chemical compound with the molecular formula C13H17I2NO2 and a molecular weight of 473.09 g/mol. IUPAC name: 2-[[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]iminomethyl]-4,6-diiodophenol. InChIKey: WVBNUUNXQNMMOB-LLVKDONJSA-N.
| Molecular formula | C13H17I2NO2 |
|---|---|
| Molecular weight | 473.09 g/mol |
| IUPAC name | 2-[[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]iminomethyl]-4,6-diiodophenol |
| InChIKey | WVBNUUNXQNMMOB-LLVKDONJSA-N |
| SMILES | CC(C)(C)[C@@H](CO)N=CC1=C(C(=CC(=C1)I)I)O |
Computed by PubChem (NCBI)