CAS 477534-83-1 is the registry number for 2,3,5-Tribromobenzaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2,3,5-tribromobenzaldehyde (CAS 477534-83-1) is a chemical compound with the molecular formula C7H3Br3O and a molecular weight of 342.81 g/mol. IUPAC name: 2,3,5-tribromobenzaldehyde. InChIKey: UHZYCTSKFLSIHD-UHFFFAOYSA-N.
| Molecular formula | C7H3Br3O |
|---|---|
| Molecular weight | 342.81 g/mol |
| IUPAC name | 2,3,5-tribromobenzaldehyde |
| InChIKey | UHZYCTSKFLSIHD-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C=O)Br)Br)Br |
Computed by PubChem (NCBI)