Products 477603-18-2
CAS 477603-18-2 appears in our catalog under these names: BN–82685, BN-82685, 99.05%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 50 mg, 25 mg, 5 mg, 100 mg, 10 mg.
5-[2-(dimethylamino)ethylamino]-2-methyl-1,3-benzothiazole-4,7-dione (CAS 477603-18-2) is a chemical compound with the molecular formula C12H15N3O2S and a molecular weight of 265.33 g/mol. IUPAC name: 5-[2-(dimethylamino)ethylamino]-2-methyl-1,3-benzothiazole-4,7-dione. InChIKey: MTUYOFGUEXWKLC-UHFFFAOYSA-N.
| Molecular formula | C12H15N3O2S |
|---|---|
| Molecular weight | 265.33 g/mol |
| IUPAC name | 5-[2-(dimethylamino)ethylamino]-2-methyl-1,3-benzothiazole-4,7-dione |
| InChIKey | MTUYOFGUEXWKLC-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(S1)C(=O)C=C(C2=O)NCCN(C)C |
Computed by PubChem (NCBI)