CAS 477712-02-0 is the registry number for 5-(4-Chlorophenyl)-1-(4-fluorophenyl)-1H-pyrazole-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 250mg, 500mg.
5-(4-chlorophenyl)-1-(4-fluorophenyl)pyrazole-3-carboxylic acid (CAS 477712-02-0) is a chemical compound with the molecular formula C16H10ClFN2O2 and a molecular weight of 316.71 g/mol. IUPAC name: 5-(4-chlorophenyl)-1-(4-fluorophenyl)pyrazole-3-carboxylic acid. InChIKey: WNSWJNDGYALZPM-UHFFFAOYSA-N.
| Molecular formula | C16H10ClFN2O2 |
|---|---|
| Molecular weight | 316.71 g/mol |
| IUPAC name | 5-(4-chlorophenyl)-1-(4-fluorophenyl)pyrazole-3-carboxylic acid |
| InChIKey | WNSWJNDGYALZPM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=NN2C3=CC=C(C=C3)F)C(=O)O)Cl |
Computed by PubChem (NCBI)