CAS 477712-33-7 is the registry number for 5-(3,4-Dichlorophenyl)-1-(4-fluorophenyl)-1H-pyrazole-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 250mg, 500mg.
5-(3,4-dichlorophenyl)-1-(4-fluorophenyl)pyrazole-3-carboxylic acid (CAS 477712-33-7) is a chemical compound with the molecular formula C16H9Cl2FN2O2 and a molecular weight of 351.2 g/mol. IUPAC name: 5-(3,4-dichlorophenyl)-1-(4-fluorophenyl)pyrazole-3-carboxylic acid. InChIKey: GZXXYOGQURAPNS-UHFFFAOYSA-N.
| Molecular formula | C16H9Cl2FN2O2 |
|---|---|
| Molecular weight | 351.2 g/mol |
| IUPAC name | 5-(3,4-dichlorophenyl)-1-(4-fluorophenyl)pyrazole-3-carboxylic acid |
| InChIKey | GZXXYOGQURAPNS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2C(=CC(=N2)C(=O)O)C3=CC(=C(C=C3)Cl)Cl)F |
Computed by PubChem (NCBI)