CAS 477775-14-7 appears in our catalog under these names: At2 receptor agonist c21, 95%, Buloxibutid/ 98.58% (existing batch purity), AT2 receptor agonist C21, AT2 receptor agonist C21, Buloxibutid 98%. Offered by: Combi-blocks, TargetMol, GLPBio, Biosynth, Ambeed. Available pack sizes: 250mg, 1g, 100mg, 1mg, 5mg, 10mg, 25mg, 50mg.
Butyl N-[3-[4-(imidazol-1-ylmethyl)phenyl]-5-(2-methylpropyl)thiophen-2-yl]sulfonylcarbamate (CAS 477775-14-7) is a chemical compound with the molecular formula C23H29N3O4S2 and a molecular weight of 475.6 g/mol. IUPAC name: butyl N-[3-[4-(imidazol-1-ylmethyl)phenyl]-5-(2-methylpropyl)thiophen-2-yl]sulfonylcarbamate. InChIKey: XTEOJPUYZWEXFI-UHFFFAOYSA-N.
| Molecular formula | C23H29N3O4S2 |
|---|---|
| Molecular weight | 475.6 g/mol |
| IUPAC name | butyl N-[3-[4-(imidazol-1-ylmethyl)phenyl]-5-(2-methylpropyl)thiophen-2-yl]sulfonylcarbamate |
| InChIKey | XTEOJPUYZWEXFI-UHFFFAOYSA-N |
| SMILES | CCCCOC(=O)NS(=O)(=O)C1=C(C=C(S1)CC(C)C)C2=CC=C(C=C2)CN3C=CN=C3 |
Computed by PubChem (NCBI)