Products 477844-47-6

CAS 477844-47-6 is the registry number for LY-33169, 99.56%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 1 mg, 25 mg, 5 mg.

Structural formula: {0} (CAS {1})

2,4-dichloro-N-(4-chlorophenyl)sulfonylbenzamide (CAS 477844-47-6) is a chemical compound with the molecular formula C13H8Cl3NO3S and a molecular weight of 364.6 g/mol. IUPAC name: 2,4-dichloro-N-(4-chlorophenyl)sulfonylbenzamide. InChIKey: DHKRVOSGULPXFM-UHFFFAOYSA-N.

Identity
Molecular formulaC13H8Cl3NO3S
Molecular weight364.6 g/mol
IUPAC name2,4-dichloro-N-(4-chlorophenyl)sulfonylbenzamide
InChIKeyDHKRVOSGULPXFM-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1S(=O)(=O)NC(=O)C2=C(C=C(C=C2)Cl)Cl)Cl

Computed by PubChem (NCBI)