CAS 477844-47-6 is the registry number for LY-33169, 99.56%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 1 mg, 25 mg, 5 mg.
2,4-dichloro-N-(4-chlorophenyl)sulfonylbenzamide (CAS 477844-47-6) is a chemical compound with the molecular formula C13H8Cl3NO3S and a molecular weight of 364.6 g/mol. IUPAC name: 2,4-dichloro-N-(4-chlorophenyl)sulfonylbenzamide. InChIKey: DHKRVOSGULPXFM-UHFFFAOYSA-N.
| Molecular formula | C13H8Cl3NO3S |
|---|---|
| Molecular weight | 364.6 g/mol |
| IUPAC name | 2,4-dichloro-N-(4-chlorophenyl)sulfonylbenzamide |
| InChIKey | DHKRVOSGULPXFM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1S(=O)(=O)NC(=O)C2=C(C=C(C=C2)Cl)Cl)Cl |
Computed by PubChem (NCBI)