CAS 477846-28-9 is the registry number for 2-(4-Benzoyl-3-cyano-5-methyl-1H-pyrrol-2-yl)malononitrile. Offered by: Biosynth. Available pack sizes: 50mg, 100mg.
2-(4-benzoyl-3-cyano-5-methyl-1H-pyrrol-2-yl)propanedinitrile (CAS 477846-28-9) is a chemical compound with the molecular formula C16H10N4O and a molecular weight of 274.28 g/mol. IUPAC name: 2-(4-benzoyl-3-cyano-5-methyl-1H-pyrrol-2-yl)propanedinitrile. InChIKey: CDUPSOLWESYIRV-UHFFFAOYSA-N.
| Molecular formula | C16H10N4O |
|---|---|
| Molecular weight | 274.28 g/mol |
| IUPAC name | 2-(4-benzoyl-3-cyano-5-methyl-1H-pyrrol-2-yl)propanedinitrile |
| InChIKey | CDUPSOLWESYIRV-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(N1)C(C#N)C#N)C#N)C(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)