CAS 477852-69-0 is the registry number for 4-(1-((2,6-Dichlorophenyl)methyl)-2-methyl-1H-imidazol-4-yl)-2-pyrimidinamine. Offered by: TRC. Available pack sizes: 100mg.
4-[1-[(2,6-dichlorophenyl)methyl]-2-methylimidazol-4-yl]pyrimidin-2-amine (CAS 477852-69-0) is a chemical compound with the molecular formula C15H13Cl2N5 and a molecular weight of 334.2 g/mol. IUPAC name: 4-[1-[(2,6-dichlorophenyl)methyl]-2-methylimidazol-4-yl]pyrimidin-2-amine. InChIKey: CKSSZTMRRVJNNG-UHFFFAOYSA-N.
| Molecular formula | C15H13Cl2N5 |
|---|---|
| Molecular weight | 334.2 g/mol |
| IUPAC name | 4-[1-[(2,6-dichlorophenyl)methyl]-2-methylimidazol-4-yl]pyrimidin-2-amine |
| InChIKey | CKSSZTMRRVJNNG-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CN1CC2=C(C=CC=C2Cl)Cl)C3=NC(=NC=C3)N |
Computed by PubChem (NCBI)