Products 477956-38-0
CAS 477956-38-0 is the registry number for Lesogaberan (napadisylate). Offered by: MedChemExpress. Available pack sizes: Get quote.
[(2R)-3-amino-2-fluoropropyl]-hydroxy-oxophosphanium;naphthalene-2-sulfonic acid (CAS 477956-38-0) is a chemical compound with the molecular formula C13H16FNO5PS+ and a molecular weight of 348.31 g/mol. IUPAC name: [(2R)-3-amino-2-fluoropropyl]-hydroxy-oxophosphanium;naphthalene-2-sulfonic acid. InChIKey: QERQFECXORQRHA-ZYRQIYSTSA-O.
| Molecular formula | C13H16FNO5PS+ |
|---|---|
| Molecular weight | 348.31 g/mol |
| IUPAC name | [(2R)-3-amino-2-fluoropropyl]-hydroxy-oxophosphanium;naphthalene-2-sulfonic acid |
| InChIKey | QERQFECXORQRHA-ZYRQIYSTSA-O |
| SMILES | C1=CC=C2C=C(C=CC2=C1)S(=O)(=O)O.C([C@H](C[P+](=O)O)F)N |
Computed by PubChem (NCBI)