Products 478-84-2
CAS 478-84-2 appears in our catalog under these names: 2-Bromo-LSD, 97.26%, 2-Bromo-D-lysergic Acid Diethylamide, >95% (HPLC), Bromolysergide. Offered by: MedChemExpress, TRC, TargetMol. Available pack sizes: 10 mg, 1 mg, 5 mg, 25mg, 50mg, 5mg, 100ug.
(6aR,9R)-5-bromo-N,N-diethyl-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide (CAS 478-84-2) is a chemical compound with the molecular formula C20H24BrN3O and a molecular weight of 402.3 g/mol. IUPAC name: (6aR,9R)-5-bromo-N,N-diethyl-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide. InChIKey: VKRAXSZEDRWLAG-SJKOYZFVSA-N.
| Molecular formula | C20H24BrN3O |
|---|---|
| Molecular weight | 402.3 g/mol |
| IUPAC name | (6aR,9R)-5-bromo-N,N-diethyl-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide |
| InChIKey | VKRAXSZEDRWLAG-SJKOYZFVSA-N |
| SMILES | CCN(CC)C(=O)[C@H]1CN([C@@H]2CC3=C(NC4=CC=CC(=C34)C2=C1)Br)C |
Computed by PubChem (NCBI)