Products 478032-97-2
CAS 478032-97-2 is the registry number for N-(1-Benzyl-3-cyano-4,5-dimethyl-1H-pyrrol-2-yl)-3-methylbenzenecarboxamide. Offered by: Biosynth. Available pack sizes: 500mg, 250mg.
N-(1-benzyl-3-cyano-4,5-dimethylpyrrol-2-yl)-3-methylbenzamide (CAS 478032-97-2) is a chemical compound with the molecular formula C22H21N3O and a molecular weight of 343.4 g/mol. IUPAC name: N-(1-benzyl-3-cyano-4,5-dimethylpyrrol-2-yl)-3-methylbenzamide. InChIKey: DDSFZKLRSHFMJA-UHFFFAOYSA-N.
| Molecular formula | C22H21N3O |
|---|---|
| Molecular weight | 343.4 g/mol |
| IUPAC name | N-(1-benzyl-3-cyano-4,5-dimethylpyrrol-2-yl)-3-methylbenzamide |
| InChIKey | DDSFZKLRSHFMJA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C(=O)NC2=C(C(=C(N2CC3=CC=CC=C3)C)C)C#N |
Computed by PubChem (NCBI)