CAS 478041-35-9 is the registry number for 2-[3-(4-Fluorobenzyl)-4-oxo-3,4-dihydro-1-phthalazinyl]acetonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-[3-[(4-fluorophenyl)methyl]-4-oxophthalazin-1-yl]acetonitrile (CAS 478041-35-9) is a chemical compound with the molecular formula C17H12FN3O and a molecular weight of 293.29 g/mol. IUPAC name: 2-[3-[(4-fluorophenyl)methyl]-4-oxophthalazin-1-yl]acetonitrile. InChIKey: QNECWPVSGTZAHT-UHFFFAOYSA-N.
| Molecular formula | C17H12FN3O |
|---|---|
| Molecular weight | 293.29 g/mol |
| IUPAC name | 2-[3-[(4-fluorophenyl)methyl]-4-oxophthalazin-1-yl]acetonitrile |
| InChIKey | QNECWPVSGTZAHT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NN(C2=O)CC3=CC=C(C=C3)F)CC#N |
Computed by PubChem (NCBI)