CAS 478047-11-9 is the registry number for 1,1,1-Trifluoro-3-(2-pyridinylsulfanyl)-2-propanol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
1,1,1-trifluoro-3-pyridin-2-ylsulfanylpropan-2-ol (CAS 478047-11-9) is a chemical compound with the molecular formula C8H8F3NOS and a molecular weight of 223.22 g/mol. IUPAC name: 1,1,1-trifluoro-3-pyridin-2-ylsulfanylpropan-2-ol. InChIKey: LNJBMCJJFXBVIB-UHFFFAOYSA-N.
| Molecular formula | C8H8F3NOS |
|---|---|
| Molecular weight | 223.22 g/mol |
| IUPAC name | 1,1,1-trifluoro-3-pyridin-2-ylsulfanylpropan-2-ol |
| InChIKey | LNJBMCJJFXBVIB-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)SCC(C(F)(F)F)O |
Computed by PubChem (NCBI)