CAS 47814-88-0 is the registry number for Bromobis(triphenylphosphine)copper, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Bromocopper;bis(triphenylphosphanium) (CAS 47814-88-0) is a chemical compound with the molecular formula C36H32BrCuP2+2 and a molecular weight of 670.0 g/mol. IUPAC name: bromocopper;bis(triphenylphosphanium). InChIKey: GSNLBOWNAFSOFV-UHFFFAOYSA-O.
| Molecular formula | C36H32BrCuP2+2 |
|---|---|
| Molecular weight | 670.0 g/mol |
| IUPAC name | bromocopper;bis(triphenylphosphanium) |
| InChIKey | GSNLBOWNAFSOFV-UHFFFAOYSA-O |
| SMILES | C1=CC=C(C=C1)[PH+](C2=CC=CC=C2)C3=CC=CC=C3.C1=CC=C(C=C1)[PH+](C2=CC=CC=C2)C3=CC=CC=C3.[Cu]Br |
Computed by PubChem (NCBI)