CAS 4784-40-1 appears in our catalog under these names: Oxomemazine HCl, Oxomemazine hydrochloride, Oxomemazine (hydrochloride). Offered by: Chemat Brand, Biosynth, MedChemExpress. Available pack sizes: on request, 25mg, 50mg, 100mg, 250mg, 500mg, Get quote.
3-(5,5-dioxophenothiazin-10-yl)-N,N,2-trimethylpropan-1-amine;hydrochloride (CAS 4784-40-1) is a chemical compound with the molecular formula C18H23ClN2O2S and a molecular weight of 366.9 g/mol. IUPAC name: 3-(5,5-dioxophenothiazin-10-yl)-N,N,2-trimethylpropan-1-amine;hydrochloride. InChIKey: NPMMOYKGIWLASW-UHFFFAOYSA-N.
| Molecular formula | C18H23ClN2O2S |
|---|---|
| Molecular weight | 366.9 g/mol |
| IUPAC name | 3-(5,5-dioxophenothiazin-10-yl)-N,N,2-trimethylpropan-1-amine;hydrochloride |
| InChIKey | NPMMOYKGIWLASW-UHFFFAOYSA-N |
| SMILES | CC(CN1C2=CC=CC=C2S(=O)(=O)C3=CC=CC=C31)CN(C)C.Cl |
Computed by PubChem (NCBI)