Products 478403-55-3
CAS 478403-55-3 appears in our catalog under these names: 4-Fluoro-[1,1'-biphenyl]-3-amine, 95%, 2-Fluoro-5-phenylaniline. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem, Biosynth. Available pack sizes: 250mg, 1g, 100mg, 10g.
2-fluoro-5-phenylaniline (CAS 478403-55-3) is a chemical compound with the molecular formula C12H10FN and a molecular weight of 187.21 g/mol. IUPAC name: 2-fluoro-5-phenylaniline. InChIKey: IUFZECBBDNMEEE-UHFFFAOYSA-N.
| Molecular formula | C12H10FN |
|---|---|
| Molecular weight | 187.21 g/mol |
| IUPAC name | 2-fluoro-5-phenylaniline |
| InChIKey | IUFZECBBDNMEEE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=C(C=C2)F)N |
Computed by PubChem (NCBI)
Synonyms:
4-fluoro-[1,1'-biphenyl]-3-amine, 4-fluoro-(1,1'-biphenyl)-3-amine, 2-fluoro-5-phenylaniline, 4-fluorobiphenyl-3-amine, [1,1'-Biphenyl]-3-amine, 4-fluoro-, 3-amino-4-fluorobiphenyl, 2-fluoro-5-phenyl-aniline, 4-Fluoro[1,1'-biphenyl]-3-amine, 1,1'-Biphenyl]-3-aMine, 4-fluoro-, 4-Fluoro-[1,1 inverted exclamation mark -biphenyl]-3-amine