CAS 478488-83-4 is the registry number for 5-Chloro-2-(5-(3-chlorothiophen-2-yl)-1,2,4-oxadiazol-3-yl)pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g.
3-(5-chloro-2-pyridinyl)-5-(3-chlorothiophen-2-yl)-1,2,4-oxadiazole (CAS 478488-83-4) is a chemical compound with the molecular formula C11H5Cl2N3OS and a molecular weight of 298.1 g/mol. IUPAC name: 3-(5-chloro-2-pyridinyl)-5-(3-chlorothiophen-2-yl)-1,2,4-oxadiazole. InChIKey: QLWZGYISUDNRSA-UHFFFAOYSA-N.
| Molecular formula | C11H5Cl2N3OS |
|---|---|
| Molecular weight | 298.1 g/mol |
| IUPAC name | 3-(5-chloro-2-pyridinyl)-5-(3-chlorothiophen-2-yl)-1,2,4-oxadiazole |
| InChIKey | QLWZGYISUDNRSA-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1Cl)C2=NOC(=N2)C3=C(C=CS3)Cl |
Computed by PubChem (NCBI)