Products 478511-26-1
CAS 478511-26-1 appears in our catalog under these names: 2'-Deoxyguanosine-1-13C Monohydrate, 2'-Deoxyguanosine-13C (monohydrate), 99.9%. Offered by: TRC, MedChemExpress. Available pack sizes: 25mg, 10 mg, 1 mg, 5 mg.
2-amino-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)(213C)oxolan-2-yl]-1H-purin-6-one;hydrate (CAS 478511-26-1) is a chemical compound with the molecular formula C10H15N5O5 and a molecular weight of 286.25 g/mol. IUPAC name: 2-amino-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)(213C)oxolan-2-yl]-1H-purin-6-one;hydrate. InChIKey: LZSCQUCOIRGCEJ-VQKPJIEUSA-N.
| Molecular formula | C10H15N5O5 |
|---|---|
| Molecular weight | 286.25 g/mol |
| IUPAC name | 2-amino-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)(213C)oxolan-2-yl]-1H-purin-6-one;hydrate |
| InChIKey | LZSCQUCOIRGCEJ-VQKPJIEUSA-N |
| SMILES | C1[C@@H]([C@H](O[13C@H]1N2C=NC3=C2N=C(NC3=O)N)CO)O.O |
Computed by PubChem (NCBI)