Products 4789-68-8
CAS 4789-68-8 appears in our catalog under these names: Octoclothepin Maleate Salt, Octoclothepin maleate salt, Octoclothepin (maleate salt), 99.14%. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 100mg, 5mg, 5 mg.
(Z)-but-2-enedioic acid;1-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)-4-methylpiperazine (CAS 4789-68-8) is a chemical compound with the molecular formula C23H25ClN2O4S and a molecular weight of 461.0 g/mol. IUPAC name: (Z)-but-2-enedioic acid;1-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)-4-methylpiperazine. InChIKey: GWKBZIADWSOIQV-BTJKTKAUSA-N.
| Molecular formula | C23H25ClN2O4S |
|---|---|
| Molecular weight | 461.0 g/mol |
| IUPAC name | (Z)-but-2-enedioic acid;1-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)-4-methylpiperazine |
| InChIKey | GWKBZIADWSOIQV-BTJKTKAUSA-N |
| SMILES | CN1CCN(CC1)C2CC3=CC=CC=C3SC4=C2C=C(C=C4)Cl.C(=C\C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)