CAS 478920-45-5 is the registry number for Rel-(2R,6R)-2,6-Dimethylpiperidin-4-ol hydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 1g.
(2R,6R)-2,6-dimethylpiperidin-4-ol;hydrochloride (CAS 478920-45-5) is a chemical compound with the molecular formula C7H16ClNO and a molecular weight of 165.66 g/mol. IUPAC name: (2R,6R)-2,6-dimethylpiperidin-4-ol;hydrochloride. InChIKey: IJIHNPOPPHLAHS-KGZKBUQUSA-N.
| Molecular formula | C7H16ClNO |
|---|---|
| Molecular weight | 165.66 g/mol |
| IUPAC name | (2R,6R)-2,6-dimethylpiperidin-4-ol;hydrochloride |
| InChIKey | IJIHNPOPPHLAHS-KGZKBUQUSA-N |
| SMILES | C[C@@H]1CC(C[C@H](N1)C)O.Cl |
Computed by PubChem (NCBI)