Products 478926-45-3
CAS 478926-45-3 is the registry number for E-3030 (free acid). Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S)-3-[3-[(2S)-3-(4-chloro-2-cyanophenoxy)-2-fluoropropoxy]phenyl]-2-propan-2-yloxypropanoic acid (CAS 478926-45-3) is a chemical compound with the molecular formula C22H23ClFNO5 and a molecular weight of 435.9 g/mol. IUPAC name: (2S)-3-[3-[(2S)-3-(4-chloro-2-cyanophenoxy)-2-fluoropropoxy]phenyl]-2-propan-2-yloxypropanoic acid. InChIKey: QICKBMIIFBKLBR-RXVVDRJESA-N.
| Molecular formula | C22H23ClFNO5 |
|---|---|
| Molecular weight | 435.9 g/mol |
| IUPAC name | (2S)-3-[3-[(2S)-3-(4-chloro-2-cyanophenoxy)-2-fluoropropoxy]phenyl]-2-propan-2-yloxypropanoic acid |
| InChIKey | QICKBMIIFBKLBR-RXVVDRJESA-N |
| SMILES | CC(C)O[C@@H](CC1=CC(=CC=C1)OC[C@@H](COC2=C(C=C(C=C2)Cl)C#N)F)C(=O)O |
Computed by PubChem (NCBI)