CAS 478951-91-6 is the registry number for [2-(Acetyloxy)-5-nitro-1,3-phenylene]di(methylene) diacetate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
[2-acetyloxy-3-(acetyloxymethyl)-5-nitrophenyl]methyl acetate (CAS 478951-91-6) is a chemical compound with the molecular formula C14H15NO8 and a molecular weight of 325.27 g/mol. IUPAC name: [2-acetyloxy-3-(acetyloxymethyl)-5-nitrophenyl]methyl acetate. InChIKey: OTONBRJUYFCXLE-UHFFFAOYSA-N.
| Molecular formula | C14H15NO8 |
|---|---|
| Molecular weight | 325.27 g/mol |
| IUPAC name | [2-acetyloxy-3-(acetyloxymethyl)-5-nitrophenyl]methyl acetate |
| InChIKey | OTONBRJUYFCXLE-UHFFFAOYSA-N |
| SMILES | CC(=O)OCC1=CC(=CC(=C1OC(=O)C)COC(=O)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)