CAS 479035-75-1 appears in our catalog under these names: Fexofenadine EP Impurity B, meta-Fexofenadine, meta–Fexofenadine, meta-Fexofenadine/ 98.76% (existing batch purity), meta-Fexofenadine, 98%, 98%. Offered by: Chemat Brand, TRC, GLPBio, TargetMol, Chemat. Available pack sizes: on request, 100mg, 25mg, 5mg, 1mg, 10mg, 50mg, 250mg.
2-[3-[1-hydroxy-4-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]butyl]phenyl]-2-methylpropanoic acid (CAS 479035-75-1) is a chemical compound with the molecular formula C32H39NO4 and a molecular weight of 501.7 g/mol. IUPAC name: 2-[3-[1-hydroxy-4-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]butyl]phenyl]-2-methylpropanoic acid. InChIKey: RYHUKJMCYGRCSM-UHFFFAOYSA-N.
| Molecular formula | C32H39NO4 |
|---|---|
| Molecular weight | 501.7 g/mol |
| IUPAC name | 2-[3-[1-hydroxy-4-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]butyl]phenyl]-2-methylpropanoic acid |
| InChIKey | RYHUKJMCYGRCSM-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=CC(=C1)C(CCCN2CCC(CC2)C(C3=CC=CC=C3)(C4=CC=CC=C4)O)O)C(=O)O |
Computed by PubChem (NCBI)