CAS 479353-60-1 appears in our catalog under these names: (4-Aminophenyl)dimethylphosphine oxide hydrochloride, 95%, 4-(Dimethylphosphinyl)benzenamine Hydrochloride, >95% (HPLC), (4–Aminophenyl)dimethylphosphine oxide hydrochloride, (4-Aminophenyl)dimethylphosphine oxide hydrochloride, 95%, 95%. Offered by: Combi-blocks, TRC, GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
4-dimethylphosphorylaniline;hydrochloride (CAS 479353-60-1) is a chemical compound with the molecular formula C8H13ClNOP and a molecular weight of 205.62 g/mol. IUPAC name: 4-dimethylphosphorylaniline;hydrochloride. InChIKey: OAHOSYPEIKFMCS-UHFFFAOYSA-N.
| Molecular formula | C8H13ClNOP |
|---|---|
| Molecular weight | 205.62 g/mol |
| IUPAC name | 4-dimethylphosphorylaniline;hydrochloride |
| InChIKey | OAHOSYPEIKFMCS-UHFFFAOYSA-N |
| SMILES | CP(=O)(C)C1=CC=C(C=C1)N.Cl |
Computed by PubChem (NCBI)