Products 479407-08-4

CAS 479407-08-4 is the registry number for Fluoroethylcholine Chloride. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-fluoroethyl-(2-hydroxyethyl)-dimethylazanium chloride (CAS 479407-08-4) is a chemical compound with the molecular formula C6H15ClFNO and a molecular weight of 171.64 g/mol. IUPAC name: 2-fluoroethyl-(2-hydroxyethyl)-dimethylazanium chloride. InChIKey: YLFIBDRAGXLYET-UHFFFAOYSA-M.

Identity
Molecular formulaC6H15ClFNO
Molecular weight171.64 g/mol
IUPAC name2-fluoroethyl-(2-hydroxyethyl)-dimethylazanium chloride
InChIKeyYLFIBDRAGXLYET-UHFFFAOYSA-M
SMILESC[N+](C)(CCO)CCF.[Cl-]

Computed by PubChem (NCBI)