Products 479544-59-7

CAS 479544-59-7 is the registry number for 4-(Cyclooct-4-en-1-yloxy)-4-oxobutanoic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

4-cyclooct-4-en-1-yloxy-4-oxobutanoate (CAS 479544-59-7) is a chemical compound with the molecular formula C12H17O4- and a molecular weight of 225.26 g/mol. IUPAC name: 4-cyclooct-4-en-1-yloxy-4-oxobutanoate. InChIKey: NGYBUUGWLHYSBO-UHFFFAOYSA-M.

Identity
Molecular formulaC12H17O4-
Molecular weight225.26 g/mol
IUPAC name4-cyclooct-4-en-1-yloxy-4-oxobutanoate
InChIKeyNGYBUUGWLHYSBO-UHFFFAOYSA-M
SMILESC1CC=CCCC(C1)OC(=O)CCC(=O)[O-]

Computed by PubChem (NCBI)