CAS 4796-75-2 is the registry number for rac 7-Methoxy Lasofoxifene. Offered by: TRC. Available pack sizes: 10mg, 25mg, 5mg.
1-[2-[4-[(1R,2S)-6-methoxy-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenoxy]ethyl]pyrrolidine (CAS 4796-75-2) is a chemical compound with the molecular formula C29H33NO2 and a molecular weight of 427.6 g/mol. IUPAC name: 1-[2-[4-[(1R,2S)-6-methoxy-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenoxy]ethyl]pyrrolidine. InChIKey: NAPIZYZVKMASNP-PXJZQJOASA-N.
| Molecular formula | C29H33NO2 |
|---|---|
| Molecular weight | 427.6 g/mol |
| IUPAC name | 1-[2-[4-[(1R,2S)-6-methoxy-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenoxy]ethyl]pyrrolidine |
| InChIKey | NAPIZYZVKMASNP-PXJZQJOASA-N |
| SMILES | COC1=CC2=C(C=C1)[C@H]([C@H](CC2)C3=CC=CC=C3)C4=CC=C(C=C4)OCCN5CCCC5 |
Computed by PubChem (NCBI)