CAS 479677-53-7 is the registry number for Gamma-Butyrobetaine-d9, >95% (HPLC). Offered by: TRC. Available pack sizes: 50mg, 5mg.
3-carboxypropyl-tris(trideuteriomethyl)azanium (CAS 479677-53-7) is a chemical compound with the molecular formula C7H16NO2+ and a molecular weight of 155.26 g/mol. IUPAC name: 3-carboxypropyl-tris(trideuteriomethyl)azanium. InChIKey: JHPNVNIEXXLNTR-GQALSZNTSA-O.
| Molecular formula | C7H16NO2+ |
|---|---|
| Molecular weight | 155.26 g/mol |
| IUPAC name | 3-carboxypropyl-tris(trideuteriomethyl)azanium |
| InChIKey | JHPNVNIEXXLNTR-GQALSZNTSA-O |
| SMILES | [2H]C([2H])([2H])[N+](CCCC(=O)O)(C([2H])([2H])[2H])C([2H])([2H])[2H] |
Computed by PubChem (NCBI)