CAS 480-30-8 is the registry number for Dichloralphenazone, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 10mg, 25mg.
1,5-dimethyl-2-phenylpyrazol-3-one;bis(2,2,2-trichloroethane-1,1-diol) (CAS 480-30-8) is a chemical compound with the molecular formula C15H18Cl6N2O5 and a molecular weight of 519.0 g/mol. IUPAC name: 1,5-dimethyl-2-phenylpyrazol-3-one;bis(2,2,2-trichloroethane-1,1-diol). InChIKey: ATKXDQOHNICLQW-UHFFFAOYSA-N.
| Molecular formula | C15H18Cl6N2O5 |
|---|---|
| Molecular weight | 519.0 g/mol |
| IUPAC name | 1,5-dimethyl-2-phenylpyrazol-3-one;bis(2,2,2-trichloroethane-1,1-diol) |
| InChIKey | ATKXDQOHNICLQW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)N(N1C)C2=CC=CC=C2.C(C(Cl)(Cl)Cl)(O)O.C(C(Cl)(Cl)Cl)(O)O |
Computed by PubChem (NCBI)