CAS 480-68-2 appears in our catalog under these names: 5–Nitrobarbituric acid, 5-Nitrobarbituric Acid Trihydrate, >98.0%(T), 5-Nitrobarbituric acid, 5-Nitrobarbituric acid, 99.91%, 6-HYDROXY-5-NITROPYRIMIDINE-2,4-DIONE, 95%. Offered by: GLPBio, TCI, Biosynth, MedChemExpress, Fluorochem. Available pack sizes: 5g, 25g, 50g, 100g, 250g, 25 g, 10 g, 1 g.
5-nitro-1,3-diazinane-2,4,6-trione (CAS 480-68-2) is a chemical compound with the molecular formula C4H3N3O5 and a molecular weight of 173.08 g/mol. IUPAC name: 5-nitro-1,3-diazinane-2,4,6-trione. InChIKey: ABICJYZKIYUWEE-UHFFFAOYSA-N.
| Molecular formula | C4H3N3O5 |
|---|---|
| Molecular weight | 173.08 g/mol |
| IUPAC name | 5-nitro-1,3-diazinane-2,4,6-trione |
| InChIKey | ABICJYZKIYUWEE-UHFFFAOYSA-N |
| SMILES | C1(C(=O)NC(=O)NC1=O)[N+](=O)[O-] |
Computed by PubChem (NCBI)