CAS 480423-17-4 appears in our catalog under these names: 4-Bromo-2-iodo-1-tosyl-1H-pyrrolo(2,3-b)pyridine, 97%, 4-Bromo-2-iodo-1-tosyl-1H-pyrrolo[2,3-b]pyridine, ≥97%, ≥97%. Offered by: AmBeed, Chemat. Available pack sizes: 100mg, 50mg.
4-bromo-2-iodo-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine (CAS 480423-17-4) is a chemical compound with the molecular formula C14H10BrIN2O2S and a molecular weight of 477.12 g/mol. IUPAC name: 4-bromo-2-iodo-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine. InChIKey: KYVSBRIXLHDOBQ-UHFFFAOYSA-N.
| Molecular formula | C14H10BrIN2O2S |
|---|---|
| Molecular weight | 477.12 g/mol |
| IUPAC name | 4-bromo-2-iodo-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine |
| InChIKey | KYVSBRIXLHDOBQ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2C(=CC3=C(C=CN=C32)Br)I |
Computed by PubChem (NCBI)