CAS 480424-79-1 is the registry number for [3-(1-Pyrrolidinylmethyl)phenyl]magnesium bromide, 0.25M solution in THF, AcroSeal®. Offered by: Thermo Scientific (Acros). Available pack sizes: 50ML.
Magnesium;1-(phenylmethyl)pyrrolidine;bromide (CAS 480424-79-1) is a chemical compound with the molecular formula C11H14BrMgN and a molecular weight of 264.44 g/mol. IUPAC name: magnesium;1-(phenylmethyl)pyrrolidine;bromide. InChIKey: XFNBNGUTGPHKQN-UHFFFAOYSA-M.
| Molecular formula | C11H14BrMgN |
|---|---|
| Molecular weight | 264.44 g/mol |
| IUPAC name | magnesium;1-(phenylmethyl)pyrrolidine;bromide |
| InChIKey | XFNBNGUTGPHKQN-UHFFFAOYSA-M |
| SMILES | C1CCN(C1)CC2=CC=C[C-]=C2.[Mg+2].[Br-] |
Computed by PubChem (NCBI)