CAS 480438-44-6 appears in our catalog under these names: (1,3–Dioxan–2–ylethyl)magnesium bromide, (1,3-DIOXAN-2-YLETHYL)MAGNESIUM BROMIDE&. Offered by: GLPBio, Sigma-Aldrich. Available pack sizes: 100ml, 500ml, 50ML.
Magnesium;2-ethyl-1,3-dioxane;bromide (CAS 480438-44-6) is a chemical compound with the molecular formula C6H11BrMgO2 and a molecular weight of 219.36 g/mol. IUPAC name: magnesium;2-ethyl-1,3-dioxane;bromide. InChIKey: SWTDOBDFYXFIPN-UHFFFAOYSA-M.
| Molecular formula | C6H11BrMgO2 |
|---|---|
| Molecular weight | 219.36 g/mol |
| IUPAC name | magnesium;2-ethyl-1,3-dioxane;bromide |
| InChIKey | SWTDOBDFYXFIPN-UHFFFAOYSA-M |
| SMILES | [CH2-]CC1OCCCO1.[Mg+2].[Br-] |
Computed by PubChem (NCBI)