CAS 480438-92-4 is the registry number for ((2,4-Difluorophenyl)ethynyl)trimethylsilane, 97%. Offered by: AmBeed. Available pack sizes: 10g.
2-(2,4-difluorophenyl)ethynyl-trimethylsilane (CAS 480438-92-4) is a chemical compound with the molecular formula C11H12F2Si and a molecular weight of 210.29 g/mol. IUPAC name: 2-(2,4-difluorophenyl)ethynyl-trimethylsilane. InChIKey: SWLZYZRQYWWIJU-UHFFFAOYSA-N.
| Molecular formula | C11H12F2Si |
|---|---|
| Molecular weight | 210.29 g/mol |
| IUPAC name | 2-(2,4-difluorophenyl)ethynyl-trimethylsilane |
| InChIKey | SWLZYZRQYWWIJU-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C#CC1=C(C=C(C=C1)F)F |
Computed by PubChem (NCBI)