CAS 480439-15-4 appears in our catalog under these names: Fluorescein O–methacrylate, Fluorescein O-methacrylate 95%, FLUORESCEIN O-METHACRYLATE, 97%, 3'-Hydroxy-3-oxo-3H-spiro[isobenzofuran-1,9'-xanthen]-6'-yl methacrylate, 97%, 97%, Fluorescein O-methacrylate, 95.80%. Offered by: GLPBio, Ambeed, Sigma-Aldrich, Chemat, MedChemExpress. Available pack sizes: 1g, 250mg, 100mg, 500MG, 50 mg, 5 mg, 25 mg, 10 mg.
(6'-hydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) 2-methylprop-2-enoate (CAS 480439-15-4) is a chemical compound with the molecular formula C24H16O6 and a molecular weight of 400.4 g/mol. IUPAC name: (6'-hydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) 2-methylprop-2-enoate. InChIKey: YMHPNLUYVDEYCI-UHFFFAOYSA-N.
| Molecular formula | C24H16O6 |
|---|---|
| Molecular weight | 400.4 g/mol |
| IUPAC name | (6'-hydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) 2-methylprop-2-enoate |
| InChIKey | YMHPNLUYVDEYCI-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)OC1=CC2=C(C=C1)C3(C4=C(O2)C=C(C=C4)O)C5=CC=CC=C5C(=O)O3 |
Computed by PubChem (NCBI)