CAS 480445-38-3 appears in our catalog under these names: potassium,(2–bromophenyl)–trifluoroboranuide, Potassium2-bromophenyltrifluoroborate 95+%, Potassium2-bromophenyltrifluoroborate, 95+%, 95+%. Offered by: GLPBio, Ambeed, Chemat. Available pack sizes: 1g, 200mg, 5g, 100mg, 250mg.
Potassium (2-bromophenyl)-trifluoroboranuide (CAS 480445-38-3) is a chemical compound with the molecular formula C6H4BBrF3K and a molecular weight of 262.91 g/mol. IUPAC name: potassium (2-bromophenyl)-trifluoroboranuide. InChIKey: ZBIFTBZXVXXMCG-UHFFFAOYSA-N.
| Molecular formula | C6H4BBrF3K |
|---|---|
| Molecular weight | 262.91 g/mol |
| IUPAC name | potassium (2-bromophenyl)-trifluoroboranuide |
| InChIKey | ZBIFTBZXVXXMCG-UHFFFAOYSA-N |
| SMILES | [B-](C1=CC=CC=C1Br)(F)(F)F.[K+] |
Computed by PubChem (NCBI)